C28H31N3O5S — CID 3700084
methyl 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxylate (PubChem CID 3700084) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is methyl 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 3700084 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | methyl 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxylate |
| SMILES | CCOc1ccc(NC(=O)CSc2nc3cc(C(=O)OC)ccc3c(=O)n2CCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C28H31N3O5S/c1-3-36-22-12-10-21(11-13-22)29-25(32)18-37-28-30-24-17-20(27(34)35-2)9-14-23(24)26(33)31(28)16-15-19-7-5-4-6-8-19/h7,9-14,17H,3-6,8,15-16,18H2,1-2H3,(H,29,32) |
| InChIKey | SGUSKAVUOZTHPM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|