C18H22N4O5S — CID 7737925
methyl 2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-3-butyl-4-oxoquinazoline-7-carboxylate (PubChem CID 7737925) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is methyl 2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-3-butyl-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-3-butyl-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 7737925 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | methyl 2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-3-butyl-4-oxoquinazoline-7-carboxylate |
| SMILES | CCCCn1c(SCC(=O)NNC(C)=O)nc2cc(C(=O)OC)ccc2c1=O |
| InChI | InChI=1S/C18H22N4O5S/c1-4-5-8-22-16(25)13-7-6-12(17(26)27-3)9-14(13)19-18(22)28-10-15(24)21-20-11(2)23/h6-7,9H,4-5,8,10H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | YQKHZUUMHZBETG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|