C21H20N2O4S — CID 7469138
methyl 4-oxo-2-(2-oxopropylsulfanyl)-3-(2-phenylethyl)quinazoline-7-carboxylate (PubChem CID 7469138) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is methyl 4-oxo-2-(2-oxopropylsulfanyl)-3-(2-phenylethyl)quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-2-(2-oxopropylsulfanyl)-3-(2-phenylethyl)quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 7469138 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | methyl 4-oxo-2-(2-oxopropylsulfanyl)-3-(2-phenylethyl)quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(CCc3ccccc3)c(SCC(C)=O)nc2c1 |
| InChI | InChI=1S/C21H20N2O4S/c1-14(24)13-28-21-22-18-12-16(20(26)27-2)8-9-17(18)19(25)23(21)11-10-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | PMSVLKKQACHBDY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |