C32H27N3O3S — CID 22333578
N-benzyl-4-oxo-2-phenacylsulfanyl-3-(2-phenylethyl)quinazoline-7-carboxamide (PubChem CID 22333578) has the molecular formula C32H27N3O3S and a molecular weight of 533.65 g/mol. Its IUPAC name is N-benzyl-4-oxo-2-phenacylsulfanyl-3-(2-phenylethyl)quinazoline-7-carboxamide.
| Compound Name | N-benzyl-4-oxo-2-phenacylsulfanyl-3-(2-phenylethyl)quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 22333578 |
| Molecular Formula | C32H27N3O3S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | N-benzyl-4-oxo-2-phenacylsulfanyl-3-(2-phenylethyl)quinazoline-7-carboxamide |
| SMILES | O=C(CSc1nc2cc(C(=O)NCc3ccccc3)ccc2c(=O)n1CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27N3O3S/c36-29(25-14-8-3-9-15-25)22-39-32-34-28-20-26(30(37)33-21-24-12-6-2-7-13-24)16-17-27(28)31(38)35(32)19-18-23-10-4-1-5-11-23/h1-17,20H,18-19,21-22H2,(H,33,37) |
| InChIKey | IKOFOIJRRGYKFN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |