C27H33N3O3S — CID 46284563
N,3-bis(3-methylbutyl)-4-oxo-2-phenacylsulfanylquinazoline-7-carboxamide (PubChem CID 46284563) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is N,3-bis(3-methylbutyl)-4-oxo-2-phenacylsulfanylquinazoline-7-carboxamide.
| Compound Name | N,3-bis(3-methylbutyl)-4-oxo-2-phenacylsulfanylquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46284563 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N,3-bis(3-methylbutyl)-4-oxo-2-phenacylsulfanylquinazoline-7-carboxamide |
| SMILES | CC(C)CCNC(=O)c1ccc2c(=O)n(CCC(C)C)c(SCC(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C27H33N3O3S/c1-18(2)12-14-28-25(32)21-10-11-22-23(16-21)29-27(30(26(22)33)15-13-19(3)4)34-17-24(31)20-8-6-5-7-9-20/h5-11,16,18-19H,12-15,17H2,1-4H3,(H,28,32) |
| InChIKey | PJUKHHMWAQJARG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |