C25H29N3O5S — CID 46284354
N-(2-methoxyethyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(2-methylpropyl)-4-oxoquinazoline-7-carboxamide (PubChem CID 46284354) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(2-methylpropyl)-4-oxoquinazoline-7-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(2-methylpropyl)-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46284354 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-(2-methoxyethyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(2-methylpropyl)-4-oxoquinazoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n(CC(C)C)c(SCC(=O)c3ccc(OC)cc3)nc2c1 |
| InChI | InChI=1S/C25H29N3O5S/c1-16(2)14-28-24(31)20-10-7-18(23(30)26-11-12-32-3)13-21(20)27-25(28)34-15-22(29)17-5-8-19(33-4)9-6-17/h5-10,13,16H,11-12,14-15H2,1-4H3,(H,26,30) |
| InChIKey | JVNDQJZXEBNDHA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|