C25H22FN3O5S — CID 22589634
2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(furan-2-ylmethyl)-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide (PubChem CID 22589634) has the molecular formula C25H22FN3O5S and a molecular weight of 495.53 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(furan-2-ylmethyl)-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide.
| Compound Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(furan-2-ylmethyl)-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 22589634 |
| Molecular Formula | C25H22FN3O5S |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(furan-2-ylmethyl)-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n(Cc3ccco3)c(SCC(=O)c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C25H22FN3O5S/c1-33-12-10-27-23(31)17-6-9-20-21(13-17)28-25(29(24(20)32)14-19-3-2-11-34-19)35-15-22(30)16-4-7-18(26)8-5-16/h2-9,11,13H,10,12,14-15H2,1H3,(H,27,31) |
| InChIKey | SOYGUISTORZAGX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|