C27H24FN3O4S — CID 46284598
3-(4-fluorophenyl)-N-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxamide (PubChem CID 46284598) has the molecular formula C27H24FN3O4S and a molecular weight of 505.57 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46284598 |
| Molecular Formula | C27H24FN3O4S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n(-c3ccc(F)cc3)c(SCC(=O)c3ccc(C)cc3)nc2c1 |
| InChI | InChI=1S/C27H24FN3O4S/c1-17-3-5-18(6-4-17)24(32)16-36-27-30-23-15-19(25(33)29-13-14-35-2)7-12-22(23)26(34)31(27)21-10-8-20(28)9-11-21/h3-12,15H,13-14,16H2,1-2H3,(H,29,33) |
| InChIKey | RLJMQPFBJQLMJA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|