C25H21F2N3O3S — CID 46361893
3-(3-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide (PubChem CID 46361893) has the molecular formula C25H21F2N3O3S and a molecular weight of 481.52 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46361893 |
| Molecular Formula | C25H21F2N3O3S |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-(3-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-N-(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n(-c3cccc(F)c3)c(SCc3ccccc3F)nc2c1 |
| InChI | InChI=1S/C25H21F2N3O3S/c1-33-12-11-28-23(31)16-9-10-20-22(13-16)29-25(34-15-17-5-2-3-8-21(17)27)30(24(20)32)19-7-4-6-18(26)14-19/h2-10,13-14H,11-12,15H2,1H3,(H,28,31) |
| InChIKey | ADVYMPGNYHGMDE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|