C26H24FN3O4S — CID 46361900
3-(3-fluorophenyl)-N-(2-methoxyethyl)-2-[(3-methoxyphenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide (PubChem CID 46361900) has the molecular formula C26H24FN3O4S and a molecular weight of 493.56 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(2-methoxyethyl)-2-[(3-methoxyphenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-(2-methoxyethyl)-2-[(3-methoxyphenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46361900 |
| Molecular Formula | C26H24FN3O4S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(2-methoxyethyl)-2-[(3-methoxyphenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n(-c3cccc(F)c3)c(SCc3cccc(OC)c3)nc2c1 |
| InChI | InChI=1S/C26H24FN3O4S/c1-33-12-11-28-24(31)18-9-10-22-23(14-18)29-26(35-16-17-5-3-8-21(13-17)34-2)30(25(22)32)20-7-4-6-19(27)15-20/h3-10,13-15H,11-12,16H2,1-2H3,(H,28,31) |
| InChIKey | WGWNBGKKROTKNB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|