C22H24ClN3O2S — CID 2431044
N-benzyl-2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 2431044) has the molecular formula C22H24ClN3O2S and a molecular weight of 429.97 g/mol. Its IUPAC name is N-benzyl-2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-benzyl-2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2431044 |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-benzyl-2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)CCn1c(SCC(=O)NCc2ccccc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C22H24ClN3O2S/c1-15(2)10-11-26-21(28)18-9-8-17(23)12-19(18)25-22(26)29-14-20(27)24-13-16-6-4-3-5-7-16/h3-9,12,15H,10-11,13-14H2,1-2H3,(H,24,27) |
| InChIKey | LAPQXIQZDVHBBV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |