C21H28ClN3O4S — CID 55322443
ethyl 4-[[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]butanoate (PubChem CID 55322443) has the molecular formula C21H28ClN3O4S and a molecular weight of 453.99 g/mol. Its IUPAC name is ethyl 4-[[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]butanoate |
|---|---|
| PubChem CID | 55322443 |
| Molecular Formula | C21H28ClN3O4S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | ethyl 4-[[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCC(C)C |
| InChI | InChI=1S/C21H28ClN3O4S/c1-4-29-19(27)6-5-10-23-18(26)13-30-21-24-17-12-15(22)7-8-16(17)20(28)25(21)11-9-14(2)3/h7-8,12,14H,4-6,9-11,13H2,1-3H3,(H,23,26) |
| InChIKey | YDGLDUYPCVMLLF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|