C15H17ClN2O3S — CID 2574962
methyl 2-[7-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 2574962) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is methyl 2-[7-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[7-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 2574962 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | methyl 2-[7-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CC(C)C |
| InChI | InChI=1S/C15H17ClN2O3S/c1-9(2)7-18-14(20)11-5-4-10(16)6-12(11)17-15(18)22-8-13(19)21-3/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | PCZTYBGTPJKECL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |