C20H20Cl2N2O2S — CID 3969444
7-chloro-2-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one (PubChem CID 3969444) has the molecular formula C20H20Cl2N2O2S and a molecular weight of 423.37 g/mol. Its IUPAC name is 7-chloro-2-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one.
| Compound Name | 7-chloro-2-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3969444 |
| Molecular Formula | C20H20Cl2N2O2S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 7-chloro-2-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one |
| SMILES | CC(C)Cn1c(SCCOc2ccccc2Cl)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H20Cl2N2O2S/c1-13(2)12-24-19(25)15-8-7-14(21)11-17(15)23-20(24)27-10-9-26-18-6-4-3-5-16(18)22/h3-8,11,13H,9-10,12H2,1-2H3 |
| InChIKey | GNGHATMYQSCCNB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|