C19H18Cl2N2OS — CID 7359679
7-chloro-2-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-propylquinazolin-4-one (PubChem CID 7359679) has the molecular formula C19H18Cl2N2OS and a molecular weight of 393.34 g/mol. Its IUPAC name is 7-chloro-2-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-propylquinazolin-4-one.
| Compound Name | 7-chloro-2-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-propylquinazolin-4-one |
|---|---|
| PubChem CID | 7359679 |
| Molecular Formula | C19H18Cl2N2OS |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 7-chloro-2-[(1S)-1-(2-chlorophenyl)ethyl]sulfanyl-3-propylquinazolin-4-one |
| SMILES | CCCn1c(S[C@@H](C)c2ccccc2Cl)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H18Cl2N2OS/c1-3-10-23-18(24)15-9-8-13(20)11-17(15)22-19(23)25-12(2)14-6-4-5-7-16(14)21/h4-9,11-12H,3,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | UDHMVRPQUWCWJH-LBPRGKRZSA-N |
| XLogP | 5.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |