C21H16Cl2N2O2S — CID 18281936
7-chloro-2-[1-(2-chlorophenyl)ethylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one (PubChem CID 18281936) has the molecular formula C21H16Cl2N2O2S and a molecular weight of 431.34 g/mol. Its IUPAC name is 7-chloro-2-[1-(2-chlorophenyl)ethylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one.
| Compound Name | 7-chloro-2-[1-(2-chlorophenyl)ethylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 18281936 |
| Molecular Formula | C21H16Cl2N2O2S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 7-chloro-2-[1-(2-chlorophenyl)ethylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one |
| SMILES | CC(Sc1nc2cc(Cl)ccc2c(=O)n1Cc1ccco1)c1ccccc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O2S/c1-13(16-6-2-3-7-18(16)23)28-21-24-19-11-14(22)8-9-17(19)20(26)25(21)12-15-5-4-10-27-15/h2-11,13H,12H2,1H3 |
| InChIKey | QRCNUGDOOHQYDK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |