C17H15ClN4O4S — CID 4818989
N-carbamoyl-2-[7-chloro-3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 4818989) has the molecular formula C17H15ClN4O4S and a molecular weight of 406.85 g/mol. Its IUPAC name is N-carbamoyl-2-[7-chloro-3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-carbamoyl-2-[7-chloro-3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 4818989 |
| Molecular Formula | C17H15ClN4O4S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N-carbamoyl-2-[7-chloro-3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nc2cc(Cl)ccc2c(=O)n1Cc1ccco1)C(=O)NC(N)=O |
| InChI | InChI=1S/C17H15ClN4O4S/c1-9(14(23)21-16(19)25)27-17-20-13-7-10(18)4-5-12(13)15(24)22(17)8-11-3-2-6-26-11/h2-7,9H,8H2,1H3,(H3,19,21,23,25) |
| InChIKey | FQDMWTLMINGPSR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |