C17H10ClN5O4S — CID 133467067
7-chloro-3-(furan-2-ylmethyl)-2-(5-nitropyrimidin-2-yl)sulfanylquinazolin-4-one (PubChem CID 133467067) has the molecular formula C17H10ClN5O4S and a molecular weight of 415.82 g/mol. Its IUPAC name is 7-chloro-3-(furan-2-ylmethyl)-2-(5-nitropyrimidin-2-yl)sulfanylquinazolin-4-one.
| Compound Name | 7-chloro-3-(furan-2-ylmethyl)-2-(5-nitropyrimidin-2-yl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 133467067 |
| Molecular Formula | C17H10ClN5O4S |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 7-chloro-3-(furan-2-ylmethyl)-2-(5-nitropyrimidin-2-yl)sulfanylquinazolin-4-one |
| SMILES | O=c1c2ccc(Cl)cc2nc(Sc2ncc([N+](=O)[O-])cn2)n1Cc1ccco1 |
| InChI | InChI=1S/C17H10ClN5O4S/c18-10-3-4-13-14(6-10)21-17(22(15(13)24)9-12-2-1-5-27-12)28-16-19-7-11(8-20-16)23(25)26/h1-8H,9H2 |
| InChIKey | UGQOIXBRSSYMQM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|