C21H21Cl2N3O2S — CID 4004323
2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chlorophenyl)acetamide (PubChem CID 4004323) has the molecular formula C21H21Cl2N3O2S and a molecular weight of 450.39 g/mol. Its IUPAC name is 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4004323 |
| Molecular Formula | C21H21Cl2N3O2S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-chlorophenyl)acetamide |
| SMILES | CC(C)CCn1c(SCC(=O)Nc2ccc(Cl)cc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H21Cl2N3O2S/c1-13(2)9-10-26-20(28)17-8-5-15(23)11-18(17)25-21(26)29-12-19(27)24-16-6-3-14(22)4-7-16/h3-8,11,13H,9-10,12H2,1-2H3,(H,24,27) |
| InChIKey | QMTFMTVMJUWKOK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |