C23H24Cl2N4O4S — CID 16542483
N'-[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-2-(4-chlorophenoxy)acetohydrazide (PubChem CID 16542483) has the molecular formula C23H24Cl2N4O4S and a molecular weight of 523.44 g/mol. Its IUPAC name is N'-[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-2-(4-chlorophenoxy)acetohydrazide.
| Compound Name | N'-[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-2-(4-chlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 16542483 |
| Molecular Formula | C23H24Cl2N4O4S |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | N'-[2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]-2-(4-chlorophenoxy)acetohydrazide |
| SMILES | CC(C)CCn1c(SCC(=O)NNC(=O)COc2ccc(Cl)cc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C23H24Cl2N4O4S/c1-14(2)9-10-29-22(32)18-8-5-16(25)11-19(18)26-23(29)34-13-21(31)28-27-20(30)12-33-17-6-3-15(24)4-7-17/h3-8,11,14H,9-10,12-13H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | AKJSFKKWBUDPFW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|