C26H27ClN4O4S — CID 16544632
2-(4-chlorophenoxy)-N'-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]acetohydrazide (PubChem CID 16544632) has the molecular formula C26H27ClN4O4S and a molecular weight of 527.05 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N'-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]acetohydrazide.
| Compound Name | 2-(4-chlorophenoxy)-N'-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]acetohydrazide |
|---|---|
| PubChem CID | 16544632 |
| Molecular Formula | C26H27ClN4O4S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-N'-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1)NNC(=O)CSc1nc2ccccc2c(=O)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C26H27ClN4O4S/c27-19-10-12-20(13-11-19)35-16-23(32)29-30-24(33)17-36-26-28-22-9-5-4-8-21(22)25(34)31(26)15-14-18-6-2-1-3-7-18/h4-6,8-13H,1-3,7,14-17H2,(H,29,32)(H,30,33) |
| InChIKey | NTTQFIIWKHNPEH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|