C18H24ClN3O3S — CID 2645284
2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide (PubChem CID 2645284) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 2645284 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCC(C)C |
| InChI | InChI=1S/C18H24ClN3O3S/c1-12(2)6-8-22-17(24)14-5-4-13(19)10-15(14)21-18(22)26-11-16(23)20-7-9-25-3/h4-5,10,12H,6-9,11H2,1-3H3,(H,20,23) |
| InChIKey | USLPHQDQEAYJRO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|