C19H26ClN3O2S — CID 16509998
2-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide (PubChem CID 16509998) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is 2-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 16509998 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CSc1nc2ccc(Cl)cc2c(=O)n1CC(C)C |
| InChI | InChI=1S/C19H26ClN3O2S/c1-12(2)7-8-21-17(24)11-26-19-22-16-6-5-14(20)9-15(16)18(25)23(19)10-13(3)4/h5-6,9,12-13H,7-8,10-11H2,1-4H3,(H,21,24) |
| InChIKey | VTQLYOYZFWWSBA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |