C17H22ClN3O2S — CID 7738113
N-butyl-2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide (PubChem CID 7738113) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is N-butyl-2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-butyl-2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7738113 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-butyl-2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCCCNC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCC |
| InChI | InChI=1S/C17H22ClN3O2S/c1-3-5-8-19-15(22)11-24-17-20-14-10-12(18)6-7-13(14)16(23)21(17)9-4-2/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,19,22) |
| InChIKey | CVFWDKSDKGXFPZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|