C20H19ClN4O3S — CID 2488439
4-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzamide (PubChem CID 2488439) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is 4-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | 4-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 2488439 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzamide |
| SMILES | CCCn1c(SCC(=O)Nc2ccc(C(N)=O)cc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H19ClN4O3S/c1-2-9-25-19(28)15-8-5-13(21)10-16(15)24-20(25)29-11-17(26)23-14-6-3-12(4-7-14)18(22)27/h3-8,10H,2,9,11H2,1H3,(H2,22,27)(H,23,26) |
| InChIKey | GNSGCPBCSPXAMU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |