C21H20ClN3O4S — CID 2488443
methyl 2-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 2488443) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is methyl 2-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2488443 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | methyl 2-[[2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CCCn1c(SCC(=O)Nc2ccccc2C(=O)OC)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H20ClN3O4S/c1-3-10-25-19(27)14-9-8-13(22)11-17(14)24-21(25)30-12-18(26)23-16-7-5-4-6-15(16)20(28)29-2/h4-9,11H,3,10,12H2,1-2H3,(H,23,26) |
| InChIKey | QADLQGFABSRXRA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |