C29H27N3O4S — CID 92864900
3-benzyl-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2-phenacylsulfanylquinazoline-7-carboxamide (PubChem CID 92864900) has the molecular formula C29H27N3O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is 3-benzyl-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2-phenacylsulfanylquinazoline-7-carboxamide.
| Compound Name | 3-benzyl-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2-phenacylsulfanylquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 92864900 |
| Molecular Formula | C29H27N3O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 3-benzyl-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2-phenacylsulfanylquinazoline-7-carboxamide |
| SMILES | O=C(CSc1nc2cc(C(=O)NC[C@H]3CCCO3)ccc2c(=O)n1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27N3O4S/c33-26(21-10-5-2-6-11-21)19-37-29-31-25-16-22(27(34)30-17-23-12-7-15-36-23)13-14-24(25)28(35)32(29)18-20-8-3-1-4-9-20/h1-6,8-11,13-14,16,23H,7,12,15,17-19H2,(H,30,34)/t23-/m1/s1 |
| InChIKey | PIFYKPVUCLFXHG-HSZRJFAPSA-N |
| XLogP | 4.33 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |