C25H29N3O4S — CID 23996830
ethyl 2-[7-(diethylcarbamoyl)-4-oxo-3-(2-phenylethyl)quinazolin-2-yl]sulfanylacetate (PubChem CID 23996830) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is ethyl 2-[7-(diethylcarbamoyl)-4-oxo-3-(2-phenylethyl)quinazolin-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[7-(diethylcarbamoyl)-4-oxo-3-(2-phenylethyl)quinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 23996830 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | ethyl 2-[7-(diethylcarbamoyl)-4-oxo-3-(2-phenylethyl)quinazolin-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc2cc(C(=O)N(CC)CC)ccc2c(=O)n1CCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-4-27(5-2)23(30)19-12-13-20-21(16-19)26-25(33-17-22(29)32-6-3)28(24(20)31)15-14-18-10-8-7-9-11-18/h7-13,16H,4-6,14-15,17H2,1-3H3 |
| InChIKey | HAJMFUOWHPACKE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |