C19H17FN2O3S — CID 2618905
ethyl 2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 2618905) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is ethyl 2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 2618905 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | ethyl 2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc2ccccc2c(=O)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O3S/c1-2-25-17(23)12-26-19-21-16-6-4-3-5-15(16)18(24)22(19)11-13-7-9-14(20)10-8-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | ZNPVMCHSZFPOBH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |