C25H22FN3O2S — CID 2531105
N-benzyl-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide (PubChem CID 2531105) has the molecular formula C25H22FN3O2S and a molecular weight of 447.54 g/mol. Its IUPAC name is N-benzyl-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-benzyl-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 2531105 |
| Molecular Formula | C25H22FN3O2S |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-benzyl-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)CSc1nc2ccccc2c(=O)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H22FN3O2S/c1-28(15-18-7-3-2-4-8-18)23(30)17-32-25-27-22-10-6-5-9-21(22)24(31)29(25)16-19-11-13-20(26)14-12-19/h2-14H,15-17H2,1H3 |
| InChIKey | OLDZEFJXWCWKCS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |