C28H28N4O3 — CID 53200341
methyl 4-oxo-3-(2-phenylethyl)-2-(4-phenylpiperazin-1-yl)quinazoline-7-carboxylate (PubChem CID 53200341) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is methyl 4-oxo-3-(2-phenylethyl)-2-(4-phenylpiperazin-1-yl)quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-3-(2-phenylethyl)-2-(4-phenylpiperazin-1-yl)quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 53200341 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | methyl 4-oxo-3-(2-phenylethyl)-2-(4-phenylpiperazin-1-yl)quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(CCc3ccccc3)c(N3CCN(c4ccccc4)CC3)nc2c1 |
| InChI | InChI=1S/C28H28N4O3/c1-35-27(34)22-12-13-24-25(20-22)29-28(32(26(24)33)15-14-21-8-4-2-5-9-21)31-18-16-30(17-19-31)23-10-6-3-7-11-23/h2-13,20H,14-19H2,1H3 |
| InChIKey | RXEPYSDOHKOKIJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |