C24H28N4O6S2 — CID 4299699
methyl 2-[2-(butylamino)-2-oxoethyl]sulfanyl-4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazoline-7-carboxylate (PubChem CID 4299699) has the molecular formula C24H28N4O6S2 and a molecular weight of 532.64 g/mol. Its IUPAC name is methyl 2-[2-(butylamino)-2-oxoethyl]sulfanyl-4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazoline-7-carboxylate.
| Compound Name | methyl 2-[2-(butylamino)-2-oxoethyl]sulfanyl-4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 4299699 |
| Molecular Formula | C24H28N4O6S2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | methyl 2-[2-(butylamino)-2-oxoethyl]sulfanyl-4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazoline-7-carboxylate |
| SMILES | CCCCNC(=O)CSc1nc2cc(C(=O)OC)ccc2c(=O)n1CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H28N4O6S2/c1-3-4-12-26-21(29)15-35-24-27-20-14-17(23(31)34-2)7-10-19(20)22(30)28(24)13-11-16-5-8-18(9-6-16)36(25,32)33/h5-10,14H,3-4,11-13,15H2,1-2H3,(H,26,29)(H2,25,32,33) |
| InChIKey | ZEBJIKPZLXLRMV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|