C19H23N3O4S — CID 2488188
methyl 3-butyl-4-oxo-2-[2-oxo-2-(prop-2-enylamino)ethyl]sulfanylquinazoline-7-carboxylate (PubChem CID 2488188) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 3-butyl-4-oxo-2-[2-oxo-2-(prop-2-enylamino)ethyl]sulfanylquinazoline-7-carboxylate.
| Compound Name | methyl 3-butyl-4-oxo-2-[2-oxo-2-(prop-2-enylamino)ethyl]sulfanylquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 2488188 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 3-butyl-4-oxo-2-[2-oxo-2-(prop-2-enylamino)ethyl]sulfanylquinazoline-7-carboxylate |
| SMILES | C=CCNC(=O)CSc1nc2cc(C(=O)OC)ccc2c(=O)n1CCCC |
| InChI | InChI=1S/C19H23N3O4S/c1-4-6-10-22-17(24)14-8-7-13(18(25)26-3)11-15(14)21-19(22)27-12-16(23)20-9-5-2/h5,7-8,11H,2,4,6,9-10,12H2,1,3H3,(H,20,23) |
| InChIKey | WWZBEATVWNFGIZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|