C19H24N2O5S — CID 7737932
methyl 3-butyl-4-oxo-2-(2-oxo-2-propan-2-yloxyethyl)sulfanylquinazoline-7-carboxylate (PubChem CID 7737932) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is methyl 3-butyl-4-oxo-2-(2-oxo-2-propan-2-yloxyethyl)sulfanylquinazoline-7-carboxylate.
| Compound Name | methyl 3-butyl-4-oxo-2-(2-oxo-2-propan-2-yloxyethyl)sulfanylquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 7737932 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl 3-butyl-4-oxo-2-(2-oxo-2-propan-2-yloxyethyl)sulfanylquinazoline-7-carboxylate |
| SMILES | CCCCn1c(SCC(=O)OC(C)C)nc2cc(C(=O)OC)ccc2c1=O |
| InChI | InChI=1S/C19H24N2O5S/c1-5-6-9-21-17(23)14-8-7-13(18(24)25-4)10-15(14)20-19(21)27-11-16(22)26-12(2)3/h7-8,10,12H,5-6,9,11H2,1-4H3 |
| InChIKey | KNXDNDKXKSONDD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |