C23H18N4O2S2 — CID 46925721
N-(4-cyanophenyl)-2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 46925721) has the molecular formula C23H18N4O2S2 and a molecular weight of 446.56 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-cyanophenyl)-2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46925721 |
| Molecular Formula | C23H18N4O2S2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-(4-cyanophenyl)-2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | N#Cc1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2CCc2cccs2)cc1 |
| InChI | InChI=1S/C23H18N4O2S2/c24-14-16-7-9-17(10-8-16)25-21(28)15-31-23-26-20-6-2-1-5-19(20)22(29)27(23)12-11-18-4-3-13-30-18/h1-10,13H,11-12,15H2,(H,25,28) |
| InChIKey | IOJFDKWWQZLWSX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |