C25H23N3O4S2 — CID 46925633
ethyl 4-[[2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate (PubChem CID 46925633) has the molecular formula C25H23N3O4S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is ethyl 4-[[2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 46925633 |
| Molecular Formula | C25H23N3O4S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | ethyl 4-[[2-[4-oxo-3-(2-thiophen-2-ylethyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2CCc2cccs2)cc1 |
| InChI | InChI=1S/C25H23N3O4S2/c1-2-32-24(31)17-9-11-18(12-10-17)26-22(29)16-34-25-27-21-8-4-3-7-20(21)23(30)28(25)14-13-19-6-5-15-33-19/h3-12,15H,2,13-14,16H2,1H3,(H,26,29) |
| InChIKey | GOZFRMUOIKRWDE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |