C25H27N5O4S — CID 24521243
6-amino-5-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]-1-cyclopropylpyrimidine-2,4-dione (PubChem CID 24521243) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is 6-amino-5-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]-1-cyclopropylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]-1-cyclopropylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24521243 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 6-amino-5-[2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]-1-cyclopropylpyrimidine-2,4-dione |
| SMILES | Nc1c(C(=O)CSc2nc3ccccc3c(=O)n2CCC2=CCCCC2)c(=O)[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C25H27N5O4S/c26-21-20(22(32)28-24(34)30(21)16-10-11-16)19(31)14-35-25-27-18-9-5-4-8-17(18)23(33)29(25)13-12-15-6-2-1-3-7-15/h4-6,8-9,16H,1-3,7,10-14,26H2,(H,28,32,34) |
| InChIKey | REJVWAJRENPCHW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|