C30H31N3O2S — CID 4660964
3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 4660964) has the molecular formula C30H31N3O2S and a molecular weight of 497.66 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 4660964 |
| Molecular Formula | C30H31N3O2S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | Cc1cc(C(=O)CSc2nc3ccccc3c(=O)n2CCC2=CCCCC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C30H31N3O2S/c1-21-19-26(22(2)33(21)24-13-7-4-8-14-24)28(34)20-36-30-31-27-16-10-9-15-25(27)29(35)32(30)18-17-23-11-5-3-6-12-23/h4,7-11,13-16,19H,3,5-6,12,17-18,20H2,1-2H3 |
| InChIKey | GVBAIJOYWZIVCN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|