C28H22FN3O2S — CID 4317797
2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one (PubChem CID 4317797) has the molecular formula C28H22FN3O2S and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 4317797 |
| Molecular Formula | C28H22FN3O2S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one |
| SMILES | Cc1cc(C(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(F)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C28H22FN3O2S/c1-18-16-24(19(2)31(18)21-8-4-3-5-9-21)26(33)17-35-28-30-25-11-7-6-10-23(25)27(34)32(28)22-14-12-20(29)13-15-22/h3-16H,17H2,1-2H3 |
| InChIKey | BULVQYWADXINLF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|