C25H21FN2O2S — CID 2360521
2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(4-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 2360521) has the molecular formula C25H21FN2O2S and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(4-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(4-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2360521 |
| Molecular Formula | C25H21FN2O2S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-(4-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CC(C)c1ccc(-n2c(SCC(=O)c3ccc(F)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H21FN2O2S/c1-16(2)17-9-13-20(14-10-17)28-24(30)21-5-3-4-6-22(21)27-25(28)31-15-23(29)18-7-11-19(26)12-8-18/h3-14,16H,15H2,1-2H3 |
| InChIKey | RJQBCMFNEZIAMN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |