C20H19FN2O3S — CID 2700658
2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(2S)-1-methoxypropan-2-yl]quinazolin-4-one (PubChem CID 2700658) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(2S)-1-methoxypropan-2-yl]quinazolin-4-one.
| Compound Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(2S)-1-methoxypropan-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 2700658 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(2S)-1-methoxypropan-2-yl]quinazolin-4-one |
| SMILES | COC[C@H](C)n1c(SCC(=O)c2ccc(F)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H19FN2O3S/c1-13(11-26-2)23-19(25)16-5-3-4-6-17(16)22-20(23)27-12-18(24)14-7-9-15(21)10-8-14/h3-10,13H,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | CVKUNMAEQZCJJG-ZDUSSCGKSA-N |
| XLogP | 3.72 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |