C24H20N2O2S — CID 7500866
2-phenacylsulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one (PubChem CID 7500866) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-phenacylsulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one.
| Compound Name | 2-phenacylsulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7500866 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-phenacylsulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one |
| SMILES | C[C@H](c1ccccc1)n1c(SCC(=O)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H20N2O2S/c1-17(18-10-4-2-5-11-18)26-23(28)20-14-8-9-15-21(20)25-24(26)29-16-22(27)19-12-6-3-7-13-19/h2-15,17H,16H2,1H3/t17-/m1/s1 |
| InChIKey | IFIMJEWFTIAGIL-QGZVFWFLSA-N |
| XLogP | 4.98 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |