C22H17BrN2O2S2 — CID 2415419
2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]sulfanyl-3-[(1S)-1-phenylethyl]quinazolin-4-one (PubChem CID 2415419) has the molecular formula C22H17BrN2O2S2 and a molecular weight of 485.43 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]sulfanyl-3-[(1S)-1-phenylethyl]quinazolin-4-one.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]sulfanyl-3-[(1S)-1-phenylethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 2415419 |
| Molecular Formula | C22H17BrN2O2S2 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 483.99 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]sulfanyl-3-[(1S)-1-phenylethyl]quinazolin-4-one |
| SMILES | C[C@@H](c1ccccc1)n1c(SCC(=O)c2ccc(Br)s2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H17BrN2O2S2/c1-14(15-7-3-2-4-8-15)25-21(27)16-9-5-6-10-17(16)24-22(25)28-13-18(26)19-11-12-20(23)29-19/h2-12,14H,13H2,1H3/t14-/m0/s1 |
| InChIKey | LSFZCLWUWVHGJH-AWEZNQCLSA-N |
| XLogP | 5.80 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |