C22H24N2O3S — CID 8010239
butyl 2-[4-oxo-3-[(1S)-1-phenylethyl]quinazolin-2-yl]sulfanylacetate (PubChem CID 8010239) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is butyl 2-[4-oxo-3-[(1S)-1-phenylethyl]quinazolin-2-yl]sulfanylacetate.
| Compound Name | butyl 2-[4-oxo-3-[(1S)-1-phenylethyl]quinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 8010239 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | butyl 2-[4-oxo-3-[(1S)-1-phenylethyl]quinazolin-2-yl]sulfanylacetate |
| SMILES | CCCCOC(=O)CSc1nc2ccccc2c(=O)n1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3S/c1-3-4-14-27-20(25)15-28-22-23-19-13-9-8-12-18(19)21(26)24(22)16(2)17-10-6-5-7-11-17/h5-13,16H,3-4,14-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | RBCDISIXPUFJCP-INIZCTEOSA-N |
| XLogP | 4.44 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|