C24H19FN2O2S — CID 8676237
2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one (PubChem CID 8676237) has the molecular formula C24H19FN2O2S and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one.
| Compound Name | 2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 8676237 |
| Molecular Formula | C24H19FN2O2S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-3-[(1R)-1-phenylethyl]quinazolin-4-one |
| SMILES | C[C@H](c1ccccc1)n1c(SCC(=O)c2cccc(F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H19FN2O2S/c1-16(17-8-3-2-4-9-17)27-23(29)20-12-5-6-13-21(20)26-24(27)30-15-22(28)18-10-7-11-19(25)14-18/h2-14,16H,15H2,1H3/t16-/m1/s1 |
| InChIKey | BSWDJPZMRMDLBI-MRXNPFEDSA-N |
| XLogP | 5.12 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |