C20H17FN2O4S — CID 8677249
methyl 3-[2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]propanoate (PubChem CID 8677249) has the molecular formula C20H17FN2O4S and a molecular weight of 400.43 g/mol. Its IUPAC name is methyl 3-[2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]propanoate.
| Compound Name | methyl 3-[2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]propanoate |
|---|---|
| PubChem CID | 8677249 |
| Molecular Formula | C20H17FN2O4S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | methyl 3-[2-[2-(3-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]propanoate |
| SMILES | COC(=O)CCn1c(SCC(=O)c2cccc(F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H17FN2O4S/c1-27-18(25)9-10-23-19(26)15-7-2-3-8-16(15)22-20(23)28-12-17(24)13-5-4-6-14(21)11-13/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | MBNAKZJENVXAJN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |