C21H21FN2O4S — CID 8606369
2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 8606369) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 8606369 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | COCCCn1c(SCC(=O)c2ccc(OC)c(F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H21FN2O4S/c1-27-11-5-10-24-20(26)15-6-3-4-7-17(15)23-21(24)29-13-18(25)14-8-9-19(28-2)16(22)12-14/h3-4,6-9,12H,5,10-11,13H2,1-2H3 |
| InChIKey | NSKORWMFIGPLLS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|