C18H15FN2O2S — CID 7680307
1-(3-fluoro-4-methoxyphenyl)-2-(2-methylquinazolin-4-yl)sulfanylethanone (PubChem CID 7680307) has the molecular formula C18H15FN2O2S and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-2-(2-methylquinazolin-4-yl)sulfanylethanone.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-2-(2-methylquinazolin-4-yl)sulfanylethanone |
|---|---|
| PubChem CID | 7680307 |
| Molecular Formula | C18H15FN2O2S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-2-(2-methylquinazolin-4-yl)sulfanylethanone |
| SMILES | COc1ccc(C(=O)CSc2nc(C)nc3ccccc23)cc1F |
| InChI | InChI=1S/C18H15FN2O2S/c1-11-20-15-6-4-3-5-13(15)18(21-11)24-10-16(22)12-7-8-17(23-2)14(19)9-12/h3-9H,10H2,1-2H3 |
| InChIKey | NORWRURZOWYLPY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |