C14H13FN2O3S — CID 135929202
2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 135929202) has the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135929202 |
| Molecular Formula | C14H13FN2O3S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(C(=O)CSc2nc(C)cc(=O)[nH]2)cc1F |
| InChI | InChI=1S/C14H13FN2O3S/c1-8-5-13(19)17-14(16-8)21-7-11(18)9-3-4-12(20-2)10(15)6-9/h3-6H,7H2,1-2H3,(H,16,17,19) |
| InChIKey | SVENXUVNQQHPSC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |