C14H13FN2O2S — CID 135924675
2-[3-(4-fluorophenyl)-3-oxopropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 135924675) has the molecular formula C14H13FN2O2S and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-3-oxopropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[3-(4-fluorophenyl)-3-oxopropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135924675 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-3-oxopropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(SCCC(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H13FN2O2S/c1-9-8-13(19)17-14(16-9)20-7-6-12(18)10-2-4-11(15)5-3-10/h2-5,8H,6-7H2,1H3,(H,16,17,19) |
| InChIKey | SHGHQJXUMPBKSR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |